CymitQuimica logo

CAS 1000576-51-1

:

1H-Indole-6-carboxylicacid, 3-cyano-, methyl ester

Description:
1H-Indole-6-carboxylic acid, 3-cyano-, methyl ester is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound features a carboxylic acid group and a cyano group at specific positions on the indole ring, along with a methyl ester functional group. The presence of the cyano group introduces notable reactivity, making it a potential candidate for various chemical transformations. The methyl ester form enhances its solubility in organic solvents, which can be advantageous for applications in organic synthesis and medicinal chemistry. This compound may exhibit biological activity, as many indole derivatives are known for their pharmacological properties. Its structural features suggest potential uses in drug development, particularly in the synthesis of compounds targeting various biological pathways. As with many chemical substances, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C11H8N2O2
InChI:InChI=1S/C11H8N2O2/c1-15-11(14)7-2-3-9-8(5-12)6-13-10(9)4-7/h2-4,6,13H,1H3
InChI key:YBZVEPCMUWGFNW-UHFFFAOYSA-N
SMILES:COC(=O)C1=CC2=C(C=C1)C(=CN2)C#N
Synonyms:
  • Methyl 3-cyanoindole-6-carboxylate
Found 5 products.