
CAS 1000577-04-7
:1-Bromo-2-chloro-3-methyl-5-(trifluoromethoxy)benzene
Description:
1-Bromo-2-chloro-3-methyl-5-(trifluoromethoxy)benzene is an aromatic compound characterized by the presence of multiple halogen substituents and a methyl group on a benzene ring. The compound features a bromine atom and a chlorine atom, which are both halogens, contributing to its reactivity and potential applications in organic synthesis. The trifluoromethoxy group (-O-CF3) enhances the compound's electron-withdrawing properties, influencing its chemical behavior and solubility. This compound is likely to exhibit moderate to high stability under standard conditions, but its reactivity can be significantly affected by the presence of the halogen substituents, which can participate in nucleophilic substitution reactions. The presence of the methyl group can also influence steric hindrance and electronic effects, affecting the compound's reactivity profile. Overall, 1-Bromo-2-chloro-3-methyl-5-(trifluoromethoxy)benzene is of interest in various fields, including pharmaceuticals and agrochemicals, due to its unique structural features and potential utility in synthetic chemistry.
Formula:C8H5BrClF3O
InChI:InChI=1S/C8H5BrClF3O/c1-4-2-5(14-8(11,12)13)3-6(9)7(4)10/h2-3H,1H3
InChI key:InChIKey=DLVWYEQUIUNXPQ-UHFFFAOYSA-N
SMILES:O(C(F)(F)F)C1=CC(Br)=C(Cl)C(C)=C1
Synonyms:- 1-Bromo-2-chloro-3-methyl-5-(trifluoromethoxy)benzene
- Benzene, 1-bromo-2-chloro-3-methyl-5-(trifluoromethoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-Bromo-2-chloro-3-methyl-5-(trifluoromethoxy)benzene
CAS:Formula:C8H5BrClF3OMolecular weight:289.4769
