CymitQuimica logo

CAS 1000577-58-1

:

1-Bromo-2,3-dichloro-5-fluorobenzene

Description:
1-Bromo-2,3-dichloro-5-fluorobenzene is an aromatic halogenated compound characterized by the presence of multiple halogen substituents on a benzene ring. Specifically, it features one bromine atom, two chlorine atoms, and one fluorine atom attached to the benzene structure. This compound is typically a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. Its molecular structure contributes to its chemical reactivity, making it useful in various synthetic applications, particularly in organic chemistry and pharmaceuticals. The presence of multiple electronegative halogens increases the compound's polarity, which can influence its solubility in different solvents. Additionally, the compound may exhibit interesting properties such as stability under certain conditions, but it can also be reactive, especially in nucleophilic substitution reactions. Safety precautions are necessary when handling this substance due to the potential toxicity and environmental impact of halogenated compounds. Overall, 1-Bromo-2,3-dichloro-5-fluorobenzene serves as a valuable intermediate in chemical synthesis and research.
Formula:C6H2BrCl2F
InChI:InChI=1S/C6H2BrCl2F/c7-4-1-3(10)2-5(8)6(4)9/h1-2H
InChI key:MWMUPKSZZWPECK-UHFFFAOYSA-N
SMILES:C1=C(C=C(C(=C1Cl)Cl)Br)F
Found 5 products.