
CAS 1000577-83-2
:1,3-Dibromo-4-chloro-2,5-difluorobenzene
Description:
1,3-Dibromo-4-chloro-2,5-difluorobenzene is an aromatic halogenated compound characterized by the presence of multiple halogen substituents on a benzene ring. Specifically, it features two bromine atoms, one chlorine atom, and two fluorine atoms attached to the benzene structure, which significantly influences its chemical properties and reactivity. The presence of these electronegative halogens contributes to the compound's polarity and can affect its solubility in various solvents. This compound is likely to exhibit a range of applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to the reactivity of the halogen substituents. Additionally, its structure suggests potential for participation in electrophilic aromatic substitution reactions. Safety data should be consulted, as halogenated compounds can pose environmental and health risks. Overall, 1,3-Dibromo-4-chloro-2,5-difluorobenzene is a complex molecule with unique properties stemming from its halogenated nature.
Formula:C6HBr2ClF2
InChI:InChI=1S/C6HBr2ClF2/c7-2-1-3(10)5(9)4(8)6(2)11/h1H
InChI key:InChIKey=YESWCYILHSPCQL-UHFFFAOYSA-N
SMILES:ClC1=C(Br)C(F)=C(Br)C=C1F
Synonyms:- Benzene, 1,3-dibromo-4-chloro-2,5-difluoro-
- 1,3-Dibromo-4-chloro-2,5-difluorobenzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.