CymitQuimica logo

CAS 1000577-84-3

:

2,4-Dichlorofuro[2,3-d]pyrimidine

Description:
2,4-Dichlorofuro[2,3-d]pyrimidine is a heterocyclic compound characterized by its fused ring structure, which incorporates both furan and pyrimidine moieties. The presence of two chlorine atoms at the 2 and 4 positions of the pyrimidine ring contributes to its chemical reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its unique structure allows for various applications in medicinal chemistry, particularly in the development of pharmaceuticals, as it may interact with biological targets due to its electron-withdrawing chlorine substituents. Additionally, the compound's properties, such as melting point, boiling point, and spectral characteristics, can vary based on its purity and the conditions under which it is synthesized or stored. Safety data should be consulted, as halogenated compounds can pose environmental and health risks. Overall, 2,4-Dichlorofuro[2,3-d]pyrimidine is of interest in both research and industrial contexts due to its distinctive chemical features.
Formula:C6H2Cl2N2O
InChI:InChI=1S/C6H2Cl2N2O/c7-4-3-1-2-11-5(3)10-6(8)9-4/h1-2H
InChI key:InChIKey=RJHMENBSHWUDOO-UHFFFAOYSA-N
SMILES:ClC1=C2C(=NC(Cl)=N1)OC=C2
Synonyms:
  • 2,4-Dichlorofuro[2,3-d]pyrimidine
  • Furo[2,3-d]pyrimidine, 2,4-dichloro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.