CAS 1000578-18-6: 2-Bromo-1-iodo-4-(1-methylethyl)benzene
Description:2-Bromo-1-iodo-4-(1-methylethyl)benzene, with the CAS number 1000578-18-6, is an organic compound characterized by the presence of both bromine and iodine substituents on a benzene ring, along with an isopropyl group. This compound features a bromine atom at the second position and an iodine atom at the first position of the benzene ring, while the isopropyl group is attached to the fourth position. The presence of these halogen atoms contributes to its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. The isopropyl group adds steric bulk, which can influence the compound's reactivity and solubility in organic solvents. Generally, compounds with halogen substituents exhibit unique physical properties, such as altered boiling and melting points compared to their non-halogenated counterparts. Additionally, the compound's structure suggests potential applications in organic synthesis and materials science, particularly in the development of pharmaceuticals or agrochemicals.
Formula:C9H10BrI
InChI:InChI=1S/C9H10BrI/c1-6(2)7-3-4-9(11)8(10)5-7/h3-6H,1-2H3
InChI key:InChIKey=YPAAYRSBEOPROG-UHFFFAOYSA-N
SMILES:BrC1=CC(=CC=C1I)C(C)C
- Synonyms:
- 2-Bromo-1-iodo-4-(1-methylethyl)benzene
- 2-Bromo-1-iodo-4-propan-2-ylbenzene
- Benzene, 2-bromo-1-iodo-4-(1-methylethyl)-
- 2-Bromo-1-iodo-4-isopropylbenzene
- 2-Bromo-1-iodo-4-(propan-2-yl)benzene
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 3-Bromo-4-iodoisopropylbenzene REF: IN-DA008XN5CAS: 1000578-18-6 | 98% | 37.00 €~513.00 € | Mon 17 Mar 25 |
![]() | 3-Bromo-4-iodoisopropylbenzene REF: 10-F035646CAS: 1000578-18-6 | 95.0% | 54.00 €~239.00 € | Thu 20 Mar 25 |
![]() | 3-Bromo-4-iodoisopropylbenzene REF: 3D-AQB57818CAS: 1000578-18-6 | Min. 95% | - - - | Discontinued product |

3-Bromo-4-iodoisopropylbenzene
Ref: IN-DA008XN5
1g | 90.00 € | ||
5g | 226.00 € | ||
100mg | 37.00 € | ||
250mg | 42.00 € |

3-Bromo-4-iodoisopropylbenzene
Ref: 10-F035646
1g | 54.00 € | ||
5g | 239.00 € |

3-Bromo-4-iodoisopropylbenzene
Ref: 3D-AQB57818
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
25g | Discontinued | Request information | |
500mg | Discontinued | Request information |