CymitQuimica logo

CAS 1000590-85-1

:

4-chloro-2-fluoro-3-methylaniline

Description:
4-Chloro-2-fluoro-3-methylaniline is an organic compound characterized by the presence of an aniline structure, which consists of an amino group (-NH2) attached to a benzene ring. In this specific compound, the benzene ring is substituted with three different groups: a chlorine atom at the para position (4-position), a fluorine atom at the ortho position (2-position), and a methyl group at the meta position (3-position). This substitution pattern influences the compound's physical and chemical properties, such as its solubility, reactivity, and potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of halogen atoms (chlorine and fluorine) typically enhances the compound's biological activity and stability. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, which can be used for its identification and analysis. Safety data sheets should be consulted for handling and toxicity information, as halogenated compounds can pose environmental and health risks.
Formula:C7H7ClFN
InChI:InChI=1S/C7H7ClFN/c1-4-5(8)2-3-6(10)7(4)9/h2-3H,10H2,1H3
InChI key:AMZYGCDRRKZPRM-UHFFFAOYSA-N
SMILES:CC1=C(C=CC(=C1F)N)Cl
Found 2 products.