CAS 100063-12-5

2-Quinolinecarboxaldehyde,6-ethoxy-(9CI)

Description:

2-Quinolinecarboxaldehyde, 6-ethoxy- (9CI), with the CAS number 100063-12-5, is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. This compound features an aldehyde functional group (-CHO) at the 2-position and an ethoxy group (-OCH2CH3) at the 6-position of the quinoline ring. It is typically a yellow to brown solid or liquid, depending on its purity and specific conditions. The presence of the aldehyde group makes it reactive, particularly in condensation reactions, while the ethoxy group can influence its solubility and reactivity. This compound may be used in various applications, including organic synthesis, as an intermediate in the production of pharmaceuticals, or in the development of agrochemicals. Its properties, such as melting point, boiling point, and solubility, can vary based on the specific formulation and environmental conditions. As with many organic compounds, proper handling and safety precautions are essential due to potential toxicity or reactivity.

Formula: C₁₂H₁₁NO₂

InChI: InChI=1/C12H11NO2/c1-2-15-11-5-6-12-9(7-11)3-4-10(8-14)13-12/h3-8H,2H2,1H3

SMILES: CCOc1ccc2c(ccc(C=O)n2)c1

Synonyms:

• 6-Ethoxyquinoline-2-Carbaldehyde

6-ethoxyquinoline-2-carbaldehyde

CAS: 100063-12-5

Formula: C₁₂H₁₁NO₂

Purity: 95.0%

Color and Shape: No data available.

Molecular weight: 201.225

Ref: 10-F308083