CAS 100063-41-0
:5-Methyl-2-phenyloxazole-4-carboxylic acid methyl ester
Description:
5-Methyl-2-phenyloxazole-4-carboxylic acid methyl ester, with the CAS number 100063-41-0, is an organic compound characterized by its oxazole ring structure, which is a five-membered heterocyclic compound containing nitrogen and oxygen. This substance features a methyl ester functional group, indicating it is an ester derived from a carboxylic acid, which contributes to its solubility in organic solvents. The presence of a phenyl group and a methyl group on the oxazole ring enhances its chemical stability and may influence its reactivity and interaction with other molecules. Typically, compounds of this nature are studied for their potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The compound may exhibit specific physical properties such as melting and boiling points, which are influenced by its molecular structure and intermolecular forces. Additionally, its reactivity can be assessed through various chemical reactions, including esterification and hydrolysis, making it a subject of interest in synthetic organic chemistry.
Formula:C12H11NO3
InChI:InChI=1S/C12H11NO3/c1-8-10(12(14)15-2)13-11(16-8)9-6-4-3-5-7-9/h3-7H,1-2H3
InChI key:InChIKey=ZFEAGDOIQORQNY-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1N=C(OC1C)C2=CC=CC=C2
Synonyms:- 4-Oxazolecarboxylic acid, 5-methyl-2-phenyl-, methyl ester
- 5-Methyl-2-phenyloxazole-4-carboxylic acid methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5-Methyl-2-phenyloxazole-4-carboxylic Acid Methyl Ester
CAS:Controlled ProductFormula:C12H11NO3Color and Shape:NeatMolecular weight:217.22
