CAS 1000698-79-2
:1-(3-Isocyanopropyl)-2-pyrrolidinone
Description:
1-(3-Isocyanopropyl)-2-pyrrolidinone is a chemical compound characterized by its unique structure, which includes a pyrrolidinone ring and an isocyanopropyl group. This compound typically exhibits properties associated with both polar and nonpolar solvents due to the presence of the isocyanate functional group, which can engage in hydrogen bonding and other intermolecular interactions. It is often used in organic synthesis and may serve as an intermediate in the production of various pharmaceuticals or agrochemicals. The isocyanate moiety can react with nucleophiles, making it a versatile building block in chemical reactions. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as temperature and pH. Safety considerations are important when handling this substance, as isocyanates can be toxic and may cause respiratory irritation. Proper storage and handling protocols should be followed to mitigate any risks associated with exposure. Overall, 1-(3-Isocyanopropyl)-2-pyrrolidinone is a valuable compound in synthetic chemistry with specific reactivity patterns.
Formula:C8H12N2O
InChI:InChI=1S/C8H12N2O/c1-9-5-3-7-10-6-2-4-8(10)11/h2-7H2
InChI key:InChIKey=WJSKUGILKGOSGT-UHFFFAOYSA-N
SMILES:C(CC[N+]#[C-])N1C(=O)CCC1
Synonyms:- 1-(3-Isocyanopropyl)-2-pyrrolidinone
- 2-Pyrrolidinone, 1-(3-isocyanopropyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.