CymitQuimica logo

CAS 1000802-52-7

:

1-(2-(pyrrolidin-1-yl)ethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole

Description:
1-(2-(Pyrrolidin-1-yl)ethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole is a chemical compound characterized by its unique structural features, which include a pyrazole ring and a pyrrolidine moiety. The presence of the dioxaborolane group suggests potential applications in organoboron chemistry, particularly in cross-coupling reactions and as a reagent in organic synthesis. This compound may exhibit properties such as moderate to high solubility in organic solvents, depending on the specific solvent and conditions. Its molecular structure indicates potential biological activity, which could be explored in medicinal chemistry. The compound's stability and reactivity can be influenced by the substituents on the pyrazole and the dioxaborolane, making it a candidate for further research in various chemical applications, including drug development and material science. As with many organoboron compounds, it may also participate in reactions that form carbon-carbon bonds, highlighting its utility in synthetic organic chemistry.
Formula:C15H26BN3O2
InChI:InChI=1S/C15H26BN3O2/c1-14(2)15(3,4)21-16(20-14)13-11-17-19(12-13)10-9-18-7-5-6-8-18/h11-12H,5-10H2,1-4H3
InChI key:LVIRZMJTRPDFGU-UHFFFAOYSA-N
SMILES:B1(OC(C(O1)(C)C)(C)C)C2=CN(N=C2)CCN3CCCC3
Found 4 products.