CAS 1000802-71-0
:4-Bromo-3-methyl-1H-pyrazole-1-propanamine
Description:
4-Bromo-3-methyl-1H-pyrazole-1-propanamine is a chemical compound characterized by its unique structure, which includes a pyrazole ring substituted with a bromine atom and a methyl group, along with a propanamine side chain. This compound typically exhibits properties associated with both heterocyclic compounds and amines, such as moderate solubility in polar solvents and potential reactivity due to the presence of the amine functional group. The bromine substitution can influence its reactivity and biological activity, making it of interest in medicinal chemistry and drug development. Additionally, the presence of the pyrazole ring may impart specific pharmacological properties, as pyrazole derivatives are known for their diverse biological activities, including anti-inflammatory and analgesic effects. The compound's molecular structure suggests it may participate in hydrogen bonding and other intermolecular interactions, which can affect its physical properties and behavior in various chemical environments. Overall, 4-Bromo-3-methyl-1H-pyrazole-1-propanamine represents a valuable compound for further research in organic and medicinal chemistry.
Formula:C7H12BrN3
InChI:InChI=1S/C7H12BrN3/c1-6-7(8)5-11(10-6)4-2-3-9/h5H,2-4,9H2,1H3
InChI key:InChIKey=PXLXYGZGMUHEBV-UHFFFAOYSA-N
SMILES:C(CCN)N1C=C(Br)C(C)=N1
Synonyms:- 1H-Pyrazole-1-propanamine, 4-bromo-3-methyl-
- 4-Bromo-3-methyl-1H-pyrazole-1-propanamine
- 3-(4-BROMO-3-METHYL-1H-PYRAZOL-1-YL)PROPAN-1-AMINE
- 3-(4-BROMO-3-METHYL-PYRAZOL-1-YL)-PROPYLAMINE
- ART-CHEM-BB B014427
- AKOS B014427
Sort by
Found 0 products.