
CAS 1000931-64-5
:N-(2-Piperidinylmethyl)sulfamide
Description:
N-(2-Piperidinylmethyl)sulfamide is an organic compound characterized by the presence of a sulfamide functional group attached to a piperidine ring. This compound typically exhibits properties associated with both amines and sulfonamides, which may influence its solubility and reactivity. It is likely to be a white to off-white solid at room temperature, with potential applications in medicinal chemistry due to its structural features that may interact with biological targets. The piperidine moiety can contribute to its pharmacological properties, potentially enhancing its ability to cross biological membranes. The compound may also exhibit moderate to high polarity, affecting its solubility in various solvents. Additionally, N-(2-Piperidinylmethyl)sulfamide may participate in hydrogen bonding due to the presence of nitrogen and sulfur atoms, which can influence its interactions in biological systems. As with many sulfamide derivatives, it may possess antibacterial or other therapeutic activities, making it of interest in drug development and research. Always handle such compounds with care, following appropriate safety protocols.
Formula:C6H15N3O2S
InChI:InChI=1S/C6H15N3O2S/c7-12(10,11)9-5-6-3-1-2-4-8-6/h6,8-9H,1-5H2,(H2,7,10,11)
InChI key:InChIKey=YFDNSOTZYQZYQP-UHFFFAOYSA-N
SMILES:C(NS(N)(=O)=O)C1CCCCN1
Synonyms:- N-(2-Piperidinylmethyl)sulfamide
- Sulfamide, N-(2-piperidinylmethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.