CAS 1000932-07-9
:6,7-Dihydro-9H-pyrano[4,3-e][1,2,4]triazolo[1,5-a]pyrimidin-9-one
Description:
6,7-Dihydro-9H-pyrano[4,3-e][1,2,4]triazolo[1,5-a]pyrimidin-9-one is a heterocyclic compound characterized by a fused ring system that incorporates both pyrimidine and triazole moieties. This compound features a pyran ring, which contributes to its unique structural properties. The presence of multiple nitrogen atoms within the triazole and pyrimidine rings enhances its potential for forming hydrogen bonds, making it a candidate for various biological activities. The compound is typically synthesized through multi-step organic reactions, often involving cyclization processes. Its potential applications may include roles in medicinal chemistry, particularly as a scaffold for developing pharmaceuticals due to its structural complexity and ability to interact with biological targets. The compound's solubility, stability, and reactivity can vary based on the functional groups present and the conditions under which it is handled. Overall, 6,7-Dihydro-9H-pyrano[4,3-e][1,2,4]triazolo[1,5-a]pyrimidin-9-one represents an interesting subject for further research in both synthetic and medicinal chemistry.
Formula:C8H6N4O2
InChI:InChI=1S/C8H6N4O2/c13-7-6-5(1-2-14-7)3-9-8-10-4-11-12(6)8/h3-4H,1-2H2
InChI key:InChIKey=VTFYQBSWPWKVSM-UHFFFAOYSA-N
SMILES:O=C1C=2N3C(N=CC2CCO1)=NC=N3
Synonyms:- 6,7-Dihydro-9H-pyrano[4,3-e][1,2,4]triazolo[1,5-a]pyrimidin-9-one
- 9H-Pyrano[4,3-e][1,2,4]triazolo[1,5-a]pyrimidin-9-one, 6,7-dihydro-
Sort by
Found 0 products.