CAS 1000932-25-1

2-[(5-Methyl-2-thiazolyl)thio]-1-(2-thienyl)ethanone

Description:

2-[(5-Methyl-2-thiazolyl)thio]-1-(2-thienyl)ethanone is a chemical compound characterized by its unique structural features, which include a thiazole ring and a thienyl group. The presence of the thiazole moiety contributes to its potential biological activity, as thiazoles are often found in various pharmaceuticals and agrochemicals. This compound typically exhibits properties such as moderate solubility in organic solvents and may have specific reactivity due to the presence of the thioether functional group. The ethanone part of the structure indicates that it contains a ketone functional group, which can participate in various chemical reactions, including nucleophilic additions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of compounds with antimicrobial or antifungal properties. Additionally, the presence of sulfur and nitrogen in the thiazole ring may influence its electronic properties, making it a candidate for further research in material science or as a ligand in coordination chemistry. Overall, this compound's unique characteristics make it of interest in various fields of chemical research.

Formula: C₁₀H₉NOS₃

InChI: InChI=1S/C10H9NOS3/c1-7-5-11-10(15-7)14-6-8(12)9-3-2-4-13-9/h2-5H,6H2,1H3

InChI key: InChIKey=VDWGCRBGGHJQLA-UHFFFAOYSA-N

SMILES: C(CSC=1SC(C)=CN1)(=O)C2=CC=CS2

Synonyms:

• 2-[(5-Methyl-2-thiazolyl)thio]-1-(2-thienyl)ethanone
• Ethanone, 2-[(5-methyl-2-thiazolyl)thio]-1-(2-thienyl)-

2-[(5-Methyl-1,3-thiazol-2-yl)sulfanyl]-1-(thiophen-2-yl)ethan-1-one

CAS: 1000932-25-1

Versatile small molecule scaffold

Formula: C₁₀H₉NOS₃

Purity: Min. 95%

Molecular weight: 255.4 g/mol

Ref: 3D-AQB93225