CymitQuimica logo

CAS 1000932-32-0

:

4-Chloro-2-(1-methyl-4(1H)-pyridinylidene)-3-oxobutanenitrile

Description:
4-Chloro-2-(1-methyl-4(1H)-pyridinylidene)-3-oxobutanenitrile is an organic compound characterized by its complex structure, which includes a chloro group, a pyridine-derived moiety, and a nitrile functional group. This compound typically exhibits a molecular formula that reflects its diverse functional groups, contributing to its potential reactivity and applications in various chemical contexts. The presence of the pyridine ring suggests possible interactions with biological systems, making it of interest in medicinal chemistry. Additionally, the oxobutanenitrile portion indicates potential for nucleophilic reactions, which can be exploited in synthetic pathways. The compound's physical properties, such as solubility and melting point, would depend on its molecular interactions and the presence of polar or nonpolar groups. Overall, 4-Chloro-2-(1-methyl-4(1H)-pyridinylidene)-3-oxobutanenitrile is a versatile compound that may serve as a building block in organic synthesis or as a lead compound in drug discovery, warranting further investigation into its chemical behavior and potential applications.
Formula:C10H9ClN2O
InChI:InChI=1S/C10H9ClN2O/c1-13-4-2-8(3-5-13)9(7-12)10(14)6-11/h2-5H,6H2,1H3
InChI key:InChIKey=GDYOGYFCFARNPF-UHFFFAOYSA-N
SMILES:C(C(CCl)=O)(C#N)=C1C=CN(C)C=C1
Synonyms:
  • Butanenitrile, 4-chloro-2-(1-methyl-4(1H)-pyridinylidene)-3-oxo-
  • 4-Chloro-2-(1-methyl-4(1H)-pyridinylidene)-3-oxobutanenitrile
Sort by

Found 0 products.