CAS 1000932-44-4

3-(2,4-Dichloro-5-thiazolyl)-1-phenyl-2-propen-1-one

Description:

3-(2,4-Dichloro-5-thiazolyl)-1-phenyl-2-propen-1-one, identified by its CAS number 1000932-44-4, is an organic compound characterized by its thiazole and phenyl functional groups. This compound typically exhibits a yellow to orange crystalline appearance and is soluble in organic solvents. It possesses a conjugated double bond system, which contributes to its potential applications in organic synthesis and as a dye or pigment. The presence of the dichloro substituents on the thiazole ring enhances its reactivity and may impart biological activity, making it of interest in pharmaceutical research. Additionally, the compound's structure suggests potential for photochemical properties, which could be explored in various applications, including materials science and phototherapy. Safety data should be consulted for handling, as halogenated compounds can exhibit toxicity and environmental persistence. Overall, this compound represents a unique intersection of organic chemistry and potential practical applications, warranting further investigation into its properties and uses.

Formula: C₁₂H₇Cl₂NOS

InChI: InChI=1S/C12H7Cl2NOS/c13-11-10(17-12(14)15-11)7-6-9(16)8-4-2-1-3-5-8/h1-7H

InChI key: InChIKey=VQOZUGCMJDJWLK-UHFFFAOYSA-N

SMILES: C(=CC(=O)C1=CC=CC=C1)C2=C(Cl)N=C(Cl)S2

Synonyms:

• 2-Propen-1-one, 3-(2,4-dichloro-5-thiazolyl)-1-phenyl-
• 3-(2,4-Dichloro-5-thiazolyl)-1-phenyl-2-propen-1-one