CAS 1000932-46-6

2-(Dimethylamino)-3-(4-methylphenyl)-3H-thieno[2,3-d]imidazole-5-carboxylic acid

Description:

2-(Dimethylamino)-3-(4-methylphenyl)-3H-thieno[2,3-d]imidazole-5-carboxylic acid is a chemical compound characterized by its complex structure, which includes a thieno[2,3-d]imidazole core fused with a carboxylic acid functional group and a dimethylamino substituent. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to its unique molecular framework. The presence of the dimethylamino group suggests it may have basic properties, while the carboxylic acid group can impart acidic characteristics. The 4-methylphenyl substituent may enhance lipophilicity, influencing its solubility and interaction with biological membranes. Such compounds are often investigated for their pharmacological potential, including roles in medicinal chemistry and drug development. Additionally, the thienoimidazole structure is known for its involvement in various chemical reactions and applications in organic synthesis. Overall, this compound's characteristics make it a subject of interest in both research and potential therapeutic applications.

Formula: C₁₅H₁₅N₃O₂S

InChI: InChI=1S/C15H15N3O2S/c1-9-4-6-10(7-5-9)18-13-11(16-15(18)17(2)3)8-12(21-13)14(19)20/h4-8H,1-3H3,(H,19,20)

InChI key: InChIKey=JQRUPZNWWKCJSH-UHFFFAOYSA-N

SMILES: N(C)(C)C=1N(C2=C(N1)C=C(C(O)=O)S2)C3=CC=C(C)C=C3

Synonyms:

• 2-(Dimethylamino)-3-(4-methylphenyl)-3H-thieno[2,3-d]imidazole-5-carboxylic acid
• 3H-Thieno[2,3-d]imidazole-5-carboxylic acid, 2-(dimethylamino)-3-(4-methylphenyl)-