CAS 1000932-48-8
:7-Cyclopropyl-1,2,3,4-tetrahydro-2,4-dioxo-1-propylpyrido[2,3-d]pyrimidine-5-carboxylic acid
Description:
7-Cyclopropyl-1,2,3,4-tetrahydro-2,4-dioxo-1-propylpyrido[2,3-d]pyrimidine-5-carboxylic acid is a complex organic compound characterized by its bicyclic structure, which incorporates both pyridine and pyrimidine rings. This compound features a cyclopropyl group, contributing to its unique reactivity and steric properties. The presence of dioxo groups indicates that it has two carbonyl functionalities, which can participate in various chemical reactions, including nucleophilic attacks and condensation reactions. The carboxylic acid functional group suggests acidic properties, allowing it to engage in proton transfer reactions. Its tetrahydro configuration implies that the compound is saturated in certain regions, which can influence its stability and solubility. This compound may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its specific interactions and potential applications would depend on further studies, including its synthesis, reactivity, and biological assays. Overall, this compound represents a fascinating area of study within organic and medicinal chemistry.
Formula:C14H15N3O4
InChI:InChI=1S/C14H15N3O4/c1-2-5-17-11-10(12(18)16-14(17)21)8(13(19)20)6-9(15-11)7-3-4-7/h6-7H,2-5H2,1H3,(H,19,20)(H,16,18,21)
InChI key:InChIKey=LMQJCPFFNQYZOC-UHFFFAOYSA-N
SMILES:C(CC)N1C=2C(=C(C(O)=O)C=C(N2)C3CC3)C(=O)NC1=O
Synonyms:- 7-Cyclopropyl-1,2,3,4-tetrahydro-2,4-dioxo-1-propylpyrido[2,3-d]pyrimidine-5-carboxylic acid
- Pyrido[2,3-d]pyrimidine-5-carboxylic acid, 7-cyclopropyl-1,2,3,4-tetrahydro-2,4-dioxo-1-propyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.