CymitQuimica logo

CAS 1000932-51-3

:

Ethyl 1-ethyl-2,3-dihydro-2-oxo-1H-benzimidazole-5-carboxylate

Description:
Ethyl 1-ethyl-2,3-dihydro-2-oxo-1H-benzimidazole-5-carboxylate, identified by its CAS number 1000932-51-3, is a chemical compound that belongs to the class of benzimidazole derivatives. This compound typically features a benzimidazole core, which is a bicyclic structure composed of a fused benzene and imidazole ring. The presence of the ethyl ester group contributes to its solubility and reactivity, making it of interest in various chemical applications. The dihydro and keto functionalities suggest potential for diverse chemical reactivity, including nucleophilic attacks and condensation reactions. Such compounds often exhibit biological activity, which may include antimicrobial or anti-inflammatory properties, making them valuable in pharmaceutical research. The structural characteristics, including the specific substituents and their positions, play a crucial role in determining the compound's physical and chemical properties, such as melting point, boiling point, and reactivity. Overall, this compound represents a significant area of interest in medicinal chemistry and organic synthesis.
Formula:C12H14N2O3
InChI:InChI=1S/C12H14N2O3/c1-3-14-10-6-5-8(11(15)17-4-2)7-9(10)13-12(14)16/h5-7H,3-4H2,1-2H3,(H,13,16)
InChI key:InChIKey=MFSDAZAXDDRYOB-UHFFFAOYSA-N
SMILES:C(C)N1C=2C(=CC(C(OCC)=O)=CC2)NC1=O
Synonyms:
  • 1H-Benzimidazole-5-carboxylic acid, 1-ethyl-2,3-dihydro-2-oxo-, ethyl ester
  • Ethyl 1-ethyl-2,3-dihydro-2-oxo-1H-benzimidazole-5-carboxylate
  • ethyl 1-ethyl-2-oxo-2,3-dihydro-1H-1,3-benzodiazole-5-carboxylate
Found 1 products.