CAS 1000932-53-5
:3-Chloro-1-[4-(4-methoxyphenyl)-1-piperazinyl]-1-propanone
Description:
3-Chloro-1-[4-(4-methoxyphenyl)-1-piperazinyl]-1-propanone, identified by its CAS number 1000932-53-5, is a chemical compound that features a piperazine ring, which is a common structural motif in many pharmaceuticals. This compound is characterized by the presence of a chloro group and a methoxyphenyl substituent, contributing to its potential biological activity. The piperazine moiety often imparts psychoactive properties, making such compounds of interest in medicinal chemistry, particularly in the development of antidepressants and antipsychotics. The carbonyl group (propanone) suggests reactivity that may be exploited in further synthetic modifications. Its solubility and stability can vary based on the solvent and environmental conditions, which are crucial for its application in biological systems. Additionally, the presence of halogen and methoxy groups can influence the compound's lipophilicity and overall pharmacokinetic profile. Understanding these characteristics is essential for evaluating its potential therapeutic uses and safety profile in drug development.
Formula:C14H19ClN2O2
InChI:InChI=1S/C14H19ClN2O2/c1-19-13-4-2-12(3-5-13)16-8-10-17(11-9-16)14(18)6-7-15/h2-5H,6-11H2,1H3
InChI key:InChIKey=GQZCLVYVGQNBET-UHFFFAOYSA-N
SMILES:C(CCCl)(=O)N1CCN(CC1)C2=CC=C(OC)C=C2
Synonyms:- 3-Chloro-1-[4-(4-methoxyphenyl)piperazin-1-yl]propan-1-one
- 3-Chloro-1-[4-(4-methoxyphenyl)-1-piperazinyl]-1-propanone
- 1-Propanone, 3-chloro-1-[4-(4-methoxyphenyl)-1-piperazinyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.