CAS 1000932-55-7
:6,7-Dihydro-2-(trifluoromethyl)-9H-pyrano[4,3-e][1,2,4]triazolo[1,5-a]pyrimidin-9-one
Description:
6,7-Dihydro-2-(trifluoromethyl)-9H-pyrano[4,3-e][1,2,4]triazolo[1,5-a]pyrimidin-9-one is a complex heterocyclic compound characterized by its unique fused ring system, which includes a pyran, triazole, and pyrimidine moiety. The presence of a trifluoromethyl group enhances its lipophilicity and may influence its biological activity. This compound typically exhibits a range of chemical properties, including stability under standard conditions, and may participate in various chemical reactions due to the presence of functional groups. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with similar frameworks often exhibit significant biological activities. The compound's CAS number, 1000932-55-7, allows for easy identification and retrieval of information in chemical databases. Overall, the unique structural features and functional groups of this compound make it a subject of interest for further research in both synthetic and medicinal chemistry.
Formula:C9H5F3N4O2
InChI:InChI=1S/C9H5F3N4O2/c10-9(11,12)7-14-8-13-3-4-1-2-18-6(17)5(4)16(8)15-7/h3H,1-2H2
InChI key:InChIKey=MWECDJQVERHWDC-UHFFFAOYSA-N
SMILES:O=C1C=2N3C(=NC(C(F)(F)F)=N3)N=CC2CCO1
Synonyms:- 9H-Pyrano[4,3-e][1,2,4]triazolo[1,5-a]pyrimidin-9-one, 6,7-dihydro-2-(trifluoromethyl)-
- 6,7-Dihydro-2-(trifluoromethyl)-9H-pyrano[4,3-e][1,2,4]triazolo[1,5-a]pyrimidin-9-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.