CAS 1000932-57-9
:1,2,3,4-Tetrahydro-7-(1-methylethyl)-2,4-dioxo-1-propylpyrido[2,3-d]pyrimidine-5-carboxylic acid
Description:
1,2,3,4-Tetrahydro-7-(1-methylethyl)-2,4-dioxo-1-propylpyrido[2,3-d]pyrimidine-5-carboxylic acid is a complex organic compound characterized by its multi-cyclic structure, which includes a pyridine and pyrimidine moiety. This substance features a tetrahydro configuration, indicating the presence of a saturated ring system, and contains multiple functional groups, including carboxylic acid and keto groups, which contribute to its reactivity and potential biological activity. The presence of the isopropyl group suggests hydrophobic characteristics, which may influence its solubility and interaction with biological membranes. The compound's dioxo functionality indicates that it may participate in various chemical reactions, including nucleophilic attacks and coordination with metal ions. Its structural complexity may also suggest potential applications in pharmaceuticals, particularly in the development of compounds with specific therapeutic effects. However, detailed studies would be necessary to fully elucidate its properties, including its stability, solubility, and biological activity.
Formula:C14H17N3O4
InChI:InChI=1S/C14H17N3O4/c1-4-5-17-11-10(12(18)16-14(17)21)8(13(19)20)6-9(15-11)7(2)3/h6-7H,4-5H2,1-3H3,(H,19,20)(H,16,18,21)
InChI key:InChIKey=AAPMEJTUSWBUCX-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C2C(N(CCC)C(=O)NC2=O)=NC(C(C)C)=C1
Synonyms:- Pyrido[2,3-d]pyrimidine-5-carboxylic acid, 1,2,3,4-tetrahydro-7-(1-methylethyl)-2,4-dioxo-1-propyl-
- 1,2,3,4-Tetrahydro-7-(1-methylethyl)-2,4-dioxo-1-propylpyrido[2,3-d]pyrimidine-5-carboxylic acid
- 2,4-Dioxo-7-(propan-2-yl)-1-propyl-1H,2H,3H,4H-pyrido[2,3-d]pyrimidine-5-carboxylic acid
Sort by
Found 0 products.