
CAS 1000932-58-0
:4-[(Dimethylamino)sulfonyl]-2-nitrobenzenesulfonyl chloride
Description:
4-[(Dimethylamino)sulfonyl]-2-nitrobenzenesulfonyl chloride, with the CAS number 1000932-58-0, is a chemical compound characterized by its sulfonamide and nitro functional groups. It typically appears as a solid or crystalline substance and is known for its reactivity, particularly due to the presence of the sulfonyl chloride group, which can participate in nucleophilic substitution reactions. This compound is often used in organic synthesis, particularly in the preparation of sulfonamide derivatives and as a reagent in various chemical transformations. Its dimethylamino group contributes to its basicity and potential for forming stable complexes with various nucleophiles. The nitro group can also influence the compound's electronic properties, making it useful in applications such as dye synthesis and pharmaceuticals. Due to its reactive nature, it should be handled with care, following appropriate safety protocols to avoid exposure to its potentially hazardous effects.
Formula:C8H9ClN2O6S2
InChI:InChI=1S/C8H9ClN2O6S2/c1-10(2)19(16,17)6-3-4-8(18(9,14)15)7(5-6)11(12)13/h3-5H,1-2H3
InChI key:InChIKey=JMPGNWKXMDCHET-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(S(Cl)(=O)=O)C=CC(S(N(C)C)(=O)=O)=C1
Synonyms:- 4-[(Dimethylamino)sulfonyl]-2-nitrobenzenesulfonyl chloride
- Benzenesulfonyl chloride, 4-[(dimethylamino)sulfonyl]-2-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.