CAS 1000932-59-1
:5-Methyl-3-isoxazolemethanesulfonyl chloride
Description:
5-Methyl-3-isoxazolemethanesulfonyl chloride is a chemical compound characterized by its isoxazole ring structure, which contributes to its reactivity and potential applications in organic synthesis. This compound features a sulfonyl chloride functional group, making it a useful reagent in various chemical reactions, particularly in the formation of sulfonamides and other sulfonyl derivatives. The presence of the methyl group at the 5-position of the isoxazole ring can influence its electronic properties and steric hindrance, affecting its reactivity. Typically, sulfonyl chlorides are known for their ability to react with nucleophiles, including amines and alcohols, to form sulfonamides and sulfonate esters, respectively. This compound may be utilized in medicinal chemistry and agrochemical applications due to its potential to modify biological molecules. However, it should be handled with care, as sulfonyl chlorides can be corrosive and may release toxic gases upon reaction with water or moisture. Proper safety precautions and handling procedures are essential when working with this compound.
Formula:C5H6ClNO3S
InChI:InChI=1S/C5H6ClNO3S/c1-4-2-5(7-10-4)3-11(6,8)9/h2H,3H2,1H3
InChI key:InChIKey=WOWWVNYKESDXKF-UHFFFAOYSA-N
SMILES:C(S(Cl)(=O)=O)C1=NOC(C)=C1
Synonyms:- 5-Methyl-3-isoxazolemethanesulfonyl chloride
- 3-Isoxazolemethanesulfonyl chloride, 5-methyl-
- (5-Methyl-1,2-oxazol-3-yl)methanesulfonyl chloride
- (5-Methylisoxazol-3-yl)methanesulfonyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.