CymitQuimica logo

CAS 1000932-68-2

:

1,1-Dimethylethyl N-[4-[2-(4-formyl-1-piperazinyl)-2-oxoethyl]phenyl]carbamate

Description:
1,1-Dimethylethyl N-[4-[2-(4-formyl-1-piperazinyl)-2-oxoethyl]phenyl]carbamate, identified by its CAS number 1000932-68-2, is a synthetic organic compound characterized by its complex structure, which includes a carbamate functional group and a piperazine moiety. This compound typically exhibits properties associated with both lipophilicity and hydrophilicity due to the presence of various functional groups, making it potentially useful in pharmaceutical applications. Its molecular structure suggests it may have biological activity, possibly acting as a ligand or inhibitor in biochemical pathways. The presence of the formyl group indicates potential reactivity, which could be exploited in further chemical modifications or in the synthesis of derivatives. Additionally, the compound's stability and solubility characteristics would depend on the specific conditions, such as pH and solvent polarity. Overall, this compound's unique structural features may contribute to its utility in medicinal chemistry and related fields.
Formula:C18H25N3O4
InChI:InChI=1S/C18H25N3O4/c1-18(2,3)25-17(24)19-15-6-4-14(5-7-15)12-16(23)21-10-8-20(13-22)9-11-21/h4-7,13H,8-12H2,1-3H3,(H,19,24)
InChI key:InChIKey=WYVUZRZEPKMPFX-UHFFFAOYSA-N
SMILES:C(CC1=CC=C(NC(OC(C)(C)C)=O)C=C1)(=O)N2CCN(C=O)CC2
Synonyms:
  • 1,1-Dimethylethyl N-[4-[2-(4-formyl-1-piperazinyl)-2-oxoethyl]phenyl]carbamate
  • Carbamic acid, N-[4-[2-(4-formyl-1-piperazinyl)-2-oxoethyl]phenyl]-, 1,1-dimethylethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.