CAS 1000932-70-6
:2-[(2-Oxo-1-pyrrolidinyl)methyl]benzonitrile
Description:
2-[(2-Oxo-1-pyrrolidinyl)methyl]benzonitrile, identified by its CAS number 1000932-70-6, is a chemical compound characterized by its unique structural features. It consists of a benzonitrile moiety, which is a benzene ring substituted with a nitrile group, and a pyrrolidinyl group that contains a carbonyl (oxo) functionality. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential solubility in organic solvents and moderate stability under standard conditions. The presence of the nitrile group suggests it may participate in nucleophilic reactions, while the pyrrolidinyl ring can influence its reactivity and interaction with biological systems. Such compounds are often of interest in medicinal chemistry due to their potential pharmacological activities. Additionally, the molecular structure may allow for various functionalization opportunities, making it a candidate for further chemical modifications. Overall, 2-[(2-Oxo-1-pyrrolidinyl)methyl]benzonitrile represents a versatile scaffold for research and development in chemical and pharmaceutical applications.
Formula:C12H12N2O
InChI:InChI=1S/C12H12N2O/c13-8-10-4-1-2-5-11(10)9-14-7-3-6-12(14)15/h1-2,4-5H,3,6-7,9H2
InChI key:InChIKey=CMNFBCHXBLLJOB-UHFFFAOYSA-N
SMILES:C(C1=C(C#N)C=CC=C1)N2C(=O)CCC2
Synonyms:- Benzonitrile, 2-[(2-oxo-1-pyrrolidinyl)methyl]-
- 2-[(2-Oxo-1-pyrrolidinyl)methyl]benzonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.