CAS 1000932-72-8
:N-(2-Aminoethyl)-1-methyl-4-(4-morpholinylsulfonyl)-1H-pyrrole-2-carboxamide
Description:
N-(2-Aminoethyl)-1-methyl-4-(4-morpholinylsulfonyl)-1H-pyrrole-2-carboxamide, with the CAS number 1000932-72-8, is a synthetic organic compound characterized by its complex structure, which includes a pyrrole ring, an amide functional group, and a morpholine moiety. This compound typically exhibits properties such as solubility in polar solvents due to the presence of amino and sulfonyl groups, which can engage in hydrogen bonding. It may possess biological activity, potentially acting as a pharmacological agent, given its structural features that are often associated with drug-like properties. The presence of the morpholine ring suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the compound's stability and reactivity can be influenced by the functional groups attached to the pyrrole ring, which may affect its application in various chemical and biological contexts. Overall, this compound represents a class of molecules that could be explored for therapeutic uses, pending further investigation into its specific biological activities and mechanisms.
Formula:C12H20N4O4S
InChI:InChI=1S/C12H20N4O4S/c1-15-9-10(8-11(15)12(17)14-3-2-13)21(18,19)16-4-6-20-7-5-16/h8-9H,2-7,13H2,1H3,(H,14,17)
InChI key:InChIKey=KZBNVXBIDOKTSV-UHFFFAOYSA-N
SMILES:S(=O)(=O)(C=1C=C(C(NCCN)=O)N(C)C1)N2CCOCC2
Synonyms:- 1H-Pyrrole-2-carboxamide, N-(2-aminoethyl)-1-methyl-4-(4-morpholinylsulfonyl)-
- N-(2-Aminoethyl)-1-methyl-4-(4-morpholinylsulfonyl)-1H-pyrrole-2-carboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.