CAS 1000932-76-2

1,2,3,4-Tetrahydro-1,3-dimethyl-2,4-dioxopyrido[2,3-d]pyrimidine-7-carboxylic acid

Description:

1,2,3,4-Tetrahydro-1,3-dimethyl-2,4-dioxopyrido[2,3-d]pyrimidine-7-carboxylic acid is a heterocyclic compound characterized by its complex bicyclic structure, which incorporates both pyridine and pyrimidine rings. This compound features a tetrahydro configuration, indicating the presence of a saturated ring system, and contains two carbonyl (dioxo) groups, contributing to its reactivity and potential biological activity. The presence of a carboxylic acid functional group suggests acidic properties, which may influence its solubility and interaction with biological systems. The dimethyl substitution on the pyrido-pyrimidine framework can affect the compound's electronic properties and steric hindrance, potentially impacting its pharmacological profile. This compound may exhibit various biological activities, making it of interest in medicinal chemistry and drug development. Its specific applications and interactions would depend on further studies, including its synthesis, stability, and biological assays. Overall, the unique structural features of this compound position it as a candidate for further research in the fields of organic and medicinal chemistry.

Formula: C₁₀H₉N₃O₄

InChI: InChI=1S/C10H9N3O4/c1-12-7-5(8(14)13(2)10(12)17)3-4-6(11-7)9(15)16/h3-4H,1-2H3,(H,15,16)

InChI key: InChIKey=ISNFJIYLRSGGKX-UHFFFAOYSA-N

SMILES: CN1C=2C(C(=O)N(C)C1=O)=CC=C(C(O)=O)N2

Synonyms:

• Pyrido[2,3-d]pyrimidine-7-carboxylic acid, 1,2,3,4-tetrahydro-1,3-dimethyl-2,4-dioxo-
• 1,2,3,4-Tetrahydro-1,3-dimethyl-2,4-dioxopyrido[2,3-d]pyrimidine-7-carboxylic acid