CAS 1000932-91-1
:2-Thiophenecarbothioamide, 5,5′-thiobis-
Description:
2-Thiophenecarbothioamide, 5,5′-thiobis- is a chemical compound characterized by its unique structure, which includes a thiophene ring and a carbothioamide functional group. This compound features a thiobis linkage, indicating the presence of two thiophenes connected by a sulfur atom, enhancing its potential for various chemical interactions. It is typically a solid at room temperature and may exhibit properties such as solubility in organic solvents, which is common for thiophene derivatives. The presence of the thiocarbonamide group suggests that it may participate in nucleophilic reactions, making it a candidate for applications in organic synthesis and materials science. Additionally, compounds with thiophene moieties are often studied for their electronic properties, which can be beneficial in the development of organic semiconductors and photovoltaic materials. As with many thiophene derivatives, it may also exhibit biological activity, warranting further investigation into its potential pharmaceutical applications. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C10H8N2S5
InChI:InChI=1S/C10H8N2S5/c11-9(13)5-1-3-7(15-5)17-8-4-2-6(16-8)10(12)14/h1-4H,(H2,11,13)(H2,12,14)
InChI key:InChIKey=ZPYRAXKLJYDCKN-UHFFFAOYSA-N
SMILES:S(C=1SC(C(N)=S)=CC1)C=2SC(C(N)=S)=CC2
Synonyms:- 2-Thiophenecarbothioamide, 5,5′-thiobis-
- 5-(5-Carbamothioylthiophen-2-yl)sulfanylthiophene-2-carbothioamide
- 5-{[5-(Aminocarbonothioyl)thien-2-yl]thio}thiophene-2-carbothioamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.