CymitQuimica logo

CAS 100098-63-3

:

N-(2-Hydroxy-1,1-dimethylethyl)-3,4-dimethoxybenzamide

Description:
N-(2-Hydroxy-1,1-dimethylethyl)-3,4-dimethoxybenzamide, with the CAS number 100098-63-3, is a chemical compound characterized by its unique structural features. It contains a benzamide moiety, which is a derivative of benzoic acid where the carboxylic acid group is replaced by an amide group. The presence of two methoxy groups (-OCH3) at the 3 and 4 positions of the benzene ring contributes to its aromatic character and can influence its solubility and reactivity. The 2-hydroxy-1,1-dimethylethyl group introduces steric hindrance and may affect the compound's biological activity and interaction with other molecules. This compound is of interest in various fields, including medicinal chemistry, due to its potential pharmacological properties. Its solubility, stability, and reactivity can vary depending on environmental conditions such as pH and temperature. Overall, the unique combination of functional groups in this compound suggests potential applications in drug development and other chemical syntheses.
Formula:C13H19NO4
InChI:InChI=1S/C13H19NO4/c1-13(2,8-15)14-12(16)9-5-6-10(17-3)11(7-9)18-4/h5-7,15H,8H2,1-4H3,(H,14,16)
InChI key:InChIKey=WPCQPYYTUFMFDC-UHFFFAOYSA-N
SMILES:C(NC(CO)(C)C)(=O)C1=CC(OC)=C(OC)C=C1
Synonyms:
  • Benzamide, N-(2-hydroxy-1,1-dimethylethyl)-3,4-dimethoxy-
  • N-(2-Hydroxy-1,1-dimethylethyl)-3,4-dimethoxybenzamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.