
CAS 1001-45-2
:6-Pentadecanone
Description:
6-Pentadecanone, with the CAS number 1001-45-2, is a ketone characterized by a long carbon chain, specifically containing 15 carbon atoms. It features a carbonyl group (C=O) located at the sixth carbon in the chain, which contributes to its chemical properties and reactivity. This compound is typically a colorless to pale yellow liquid with a waxy texture and a distinctive odor, often described as fatty or waxy. It is soluble in organic solvents but has limited solubility in water due to its hydrophobic nature. 6-Pentadecanone is used in various applications, including as a flavoring agent and in the synthesis of other organic compounds. Its presence in natural products and its potential biological activities make it of interest in both industrial and research contexts. Additionally, like other long-chain ketones, it may exhibit properties such as stability under certain conditions and susceptibility to oxidation, which can influence its behavior in different environments.
Formula:C15H30O
InChI:InChI=1S/C15H30O/c1-3-5-7-8-9-10-12-14-15(16)13-11-6-4-2/h3-14H2,1-2H3
InChI key:InChIKey=YSHXMTRDMDYAEC-UHFFFAOYSA-N
SMILES:C(C(CCCCC)=O)CCCCCCCC
Synonyms:- 6-Pentadecanone
- NSC 158526
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
