CAS 1001-46-3
:silane, (1-hexylheptyl)-
Description:
Silane, (1-hexylheptyl)-, with the CAS number 1001-46-3, is an organosilicon compound characterized by its silane functional group, which consists of silicon bonded to hydrogen and organic alkyl groups. This compound features a long hydrocarbon chain, specifically a hexyl group attached to a heptyl group, contributing to its hydrophobic nature. Silanes are typically used in various applications, including as coupling agents, surface modifiers, and in the synthesis of silicone polymers. The presence of multiple carbon chains enhances its compatibility with organic materials, making it useful in enhancing adhesion properties in coatings and sealants. Additionally, silanes can exhibit varying degrees of reactivity depending on their structure, influencing their behavior in chemical reactions and interactions with other substances. Safety considerations should be taken into account, as silanes can be flammable and may pose health risks if inhaled or ingested. Overall, (1-hexylheptyl)-silane is a versatile compound with significant industrial applications, particularly in materials science and surface chemistry.
Formula:C13H30Si
InChI:InChI=1/C13H30Si/c1-3-5-7-9-11-13(14)12-10-8-6-4-2/h13H,3-12H2,1-2,14H3
Synonyms:- Tridecan-7-ylsilane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
