CymitQuimica logo

CAS 1001-75-8

:

4-Pentenoic acid, 4-methyl-

Description:
4-Pentenoic acid, 4-methyl- is an organic compound characterized by its unsaturated carboxylic acid structure. It features a five-carbon chain with a double bond located at the 4-position and a methyl group also at the 4-position, which contributes to its branched structure. This compound is typically a colorless to pale yellow liquid with a distinctive odor. It is soluble in organic solvents and exhibits moderate solubility in water due to the presence of the carboxylic acid functional group. The presence of the double bond makes it reactive, allowing for various chemical transformations, such as polymerization and addition reactions. 4-Pentenoic acid, 4-methyl- is used in the synthesis of various chemical intermediates and can serve as a building block in organic synthesis. Safety data indicates that it should be handled with care, as it may cause irritation to the skin and eyes. Proper storage and handling procedures are essential to minimize exposure and ensure safety in laboratory or industrial settings.
Formula:C6H10O2
InChI:InChI=1S/C6H10O2/c1-5(2)3-4-6(7)8/h1,3-4H2,2H3,(H,7,8)
InChI key:HVHBTFZQLHOFHA-UHFFFAOYSA-N
SMILES:CC(=C)CCC(=O)O
Found 3 products.