CymitQuimica logo

CAS 10010-36-3

:

4-[(E)-2-(4-fluorophenyl)ethenyl]aniline

Description:
4-[(E)-2-(4-fluorophenyl)ethenyl]aniline, with the CAS number 10010-36-3, is an organic compound characterized by its structure, which includes an aniline moiety and a vinyl group substituted with a fluorophenyl group. This compound typically exhibits properties associated with both aromatic amines and alkenes, such as potential reactivity in electrophilic substitution reactions due to the presence of the aniline nitrogen. The fluorine atom in the para position of the phenyl ring can influence the compound's electronic properties, enhancing its reactivity and potentially affecting its solubility in various solvents. Additionally, the E configuration of the ethenyl group suggests a specific geometric arrangement that can impact the compound's physical properties, such as melting and boiling points. This compound may also have applications in organic synthesis, materials science, or as an intermediate in the production of more complex chemical entities. Safety and handling precautions should be observed due to the potential toxicity associated with aromatic amines.
Formula:C14H12FN
InChI:InChI=1/C14H12FN/c15-13-7-3-11(4-8-13)1-2-12-5-9-14(16)10-6-12/h1-10H,16H2/b2-1+
Synonyms:
  • benzenamine, 4-[(E)-2-(4-fluorophenyl)ethenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.