
CAS 1001010-59-8
:5-(2-Fluoro-4-methylphenyl)-2-furancarboxaldehyde
Description:
5-(2-Fluoro-4-methylphenyl)-2-furancarboxaldehyde is an organic compound characterized by its unique structure, which includes a furan ring and an aldehyde functional group. The presence of a fluorine atom and a methyl group on the aromatic ring contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. This compound typically exhibits moderate polarity due to the furan and aldehyde functionalities, influencing its solubility in organic solvents. Its molecular structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry. The compound may also participate in electrophilic aromatic substitution reactions due to the electron-withdrawing nature of the fluorine atom. Additionally, its aldehyde group can undergo oxidation or condensation reactions, further expanding its utility in synthetic organic chemistry. Safety and handling precautions should be observed, as with many organic compounds, to mitigate any potential hazards associated with exposure.
Formula:C12H9FO2
InChI:InChI=1S/C12H9FO2/c1-8-2-4-10(11(13)6-8)12-5-3-9(7-14)15-12/h2-7H,1H3
InChI key:InChIKey=NSIQLNQNWATRBC-UHFFFAOYSA-N
SMILES:FC1=C(C=2OC(C=O)=CC2)C=CC(C)=C1
Synonyms:- 2-Furancarboxaldehyde, 5-(2-fluoro-4-methylphenyl)-
- 5-(2-Fluoro-4-methylphenyl)-2-furancarboxaldehyde
Sort by
Found 0 products.