CAS 1001050-24-3

2-Bromo-5-hydrazinopyrazine

Description:

2-Bromo-5-hydrazinopyrazine is a chemical compound characterized by its pyrazine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at non-adjacent positions. The presence of a bromine atom at the 2-position and a hydrazine group (-NH-NH2) at the 5-position contributes to its reactivity and potential applications in various fields, including medicinal chemistry and agrochemicals. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the hydrazine functional group. Its reactivity can be attributed to the electrophilic nature of the bromine atom and the nucleophilic properties of the hydrazine moiety, making it a candidate for further chemical transformations. Additionally, 2-Bromo-5-hydrazinopyrazine may exhibit biological activity, which warrants investigation for potential therapeutic applications. Safety data should be consulted, as halogenated compounds can pose health risks, and appropriate handling procedures should be followed in laboratory settings.

Formula: C₄H₅BrN₄

InChI: InChI=1S/C4H5BrN4/c5-3-1-8-4(9-6)2-7-3/h1-2H,6H2,(H,8,9)

SMILES: c1c(Br)ncc(=NN)[nH]1

Synonyms:

• 5-Bromo-2-Hydrazinopyrazine

Pyrazine, 2-bromo-5-hydrazinyl-

CAS: 1001050-24-3

Formula: C₄H₅BrN₄

Purity: 98%

Molecular weight: 189.0133

Ref: IN-DA0000YK

2-Bromo-5-hydrazinopyrazine

CAS: 1001050-24-3

2-Bromo-5-hydrazinopyrazine

Purity: 95%

Molecular weight: 189.02g/mol

Ref: 54-OR1003129

2-Bromo-5-hydrazinopyrazine

CAS: 1001050-24-3

Versatile small molecule scaffold

Formula: C₄H₅BrN₄

Purity: Min. 95%

Molecular weight: 189.01 g/mol

Ref: 3D-BQB05024