
CAS 1001057-09-5
:5-Amino-2-bromo-N,N-diethylbenzenemethanamine
Description:
5-Amino-2-bromo-N,N-diethylbenzenemethanamine is an organic compound characterized by its amino and bromo functional groups attached to a benzene ring. The presence of the amino group (-NH2) indicates that it can act as a base and participate in various chemical reactions, such as nucleophilic substitutions. The diethyl groups suggest that the compound has significant steric hindrance, which may influence its reactivity and solubility in different solvents. The bromine atom introduces a halogen, which can enhance the compound's reactivity, particularly in electrophilic aromatic substitution reactions. This compound may exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can affect its physical properties like boiling and melting points. Additionally, the presence of both the amino and bromo groups may allow for further functionalization, making it a potentially useful intermediate in organic synthesis. Safety data should be consulted, as compounds with amine and halogen functionalities can pose health risks and require careful handling.
Formula:C11H17BrN2
InChI:InChI=1S/C11H17BrN2/c1-3-14(4-2)8-9-7-10(13)5-6-11(9)12/h5-7H,3-4,8,13H2,1-2H3
InChI key:InChIKey=RZHBCQDIENKROB-UHFFFAOYSA-N
SMILES:C(N(CC)CC)C1=C(Br)C=CC(N)=C1
Synonyms:- Benzenemethanamine, 5-amino-2-bromo-N,N-diethyl-
- 5-Amino-2-bromo-N,N-diethylbenzenemethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.