CAS 1001100-69-1
:(3β,7β,17α)-Pregn-5-en-20-yne-3,7,17-triol
Description:
The chemical substance known as (3β,7β,17α)-Pregn-5-en-20-yne-3,7,17-triol, with the CAS number 1001100-69-1, is a steroid compound characterized by its specific structural features, including a steroid nucleus and multiple hydroxyl (-OH) groups. This compound is a derivative of progesterone and is classified as a trihydroxy steroid, indicating the presence of three hydroxyl functional groups at the 3, 7, and 17 positions of the steroid backbone. The presence of a triple bond in the 20 position contributes to its unique reactivity and biological properties. Steroids like this one are often involved in various physiological processes, including hormone regulation and signaling pathways. The stereochemistry of the compound, denoted by the specific β and α configurations, plays a crucial role in its biological activity and interaction with steroid receptors. Overall, this compound is of interest in both medicinal chemistry and biochemistry for its potential applications in hormone therapy and research into steroid metabolism.
Formula:C21H30O3
InChI:InChI=1S/C21H30O3/c1-4-21(24)10-7-16-18-15(6-9-20(16,21)3)19(2)8-5-14(22)11-13(19)12-17(18)23/h1,12,14-18,22-24H,5-11H2,2-3H3/t14-,15-,16-,17-,18+,19-,20-,21-/m0/s1
InChI key:InChIKey=JJKOQZHWYLMASZ-FJWDNACWSA-N
SMILES:O[C@@H]1[C@]2([C@]3([C@@](C)([C@@](C#C)(O)CC3)CC[C@@]2([C@]4(C)C(=C1)C[C@@H](O)CC4)[H])[H])[H]
Synonyms:- Pregn-5-en-20-yne-3,7,17-triol, (3β,7β,17α)-
- HE 3286
- Triolex
- 17α-Ethynylandrost-5-ene-3β,7β,17β-triol
- (3β,7β,17α)-Pregn-5-en-20-yne-3,7,17-triol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
HE 3286
CAS:Triolex, an NF-kB inhibitor, is used potentially for the treatment of rheumatoid arthritis, ulcerative colitis.Formula:C21H30O3Color and Shape:SolidMolecular weight:330.46
