CAS 100111-14-6
:4-nph-6-deoxy-6-(2-pyridylamino)-alpha-penta-(1->4)glucopy
Description:
4-nph-6-deoxy-6-(2-pyridylamino)-alpha-penta-(1->4)glucopyranoside, with the CAS number 100111-14-6, is a glycosylated compound characterized by its complex structure that includes a pyridylamino group and a glucopyranoside backbone. This substance is notable for its potential applications in biochemistry and medicinal chemistry, particularly in the study of carbohydrate-protein interactions and as a potential ligand in various biological systems. The presence of the 2-pyridylamino moiety may impart unique properties, such as enhanced solubility or specific binding affinities, which can be advantageous in drug design and development. Additionally, the alpha-(1→4) glycosidic linkages in the glucopyranoside structure suggest that it may exhibit specific enzymatic interactions, making it of interest in enzymology and carbohydrate chemistry. Overall, this compound exemplifies the intricate relationship between structure and function in chemical biology, highlighting the importance of glycosylation in modulating biological activity.
Formula:C41H59N3O27
InChI:InChI=1/C41H59N3O27/c45-11-17-32(23(50)28(55)37(64-17)62-15-6-4-14(5-7-15)44(60)61)68-39-29(56)24(51)34(19(13-47)65-39)69-41-31(58)26(53)35(36(59)71-41)70-40-30(57)25(52)33(18(12-46)66-40)67-38-27(54)22(49)21(48)16(63-38)8-10-43-20-3-1-2-9-42-20/h1-7,9,16-19,21-41,45-59H,8,10-13H2,(H,42,43)/t16-,17-,18-,19-,21-,22+,23-,24-,25-,26-,27-,28-,29-,30-,31-,32+,33-,34-,35?,36+,37+,38-,39-,40-,41+/m1/s1
Synonyms:- 4-Nitrophenyl-6-deoxy-6-(2-pyridylamino)-alpha-D-penta-(14)- glucopyranoside
- (2S,4R,5R,6S)-6-{[(2R,3S,4R,5R,6R)-6-{[(2R,3R,4R,5R,6R)-4,5-dihydroxy-2-(hydroxymethyl)-6-(4-nitrophenoxy)tetrahydro-2H-pyran-3-yl]oxy}-4,5-dihydroxy-2-(hydroxymethyl)tetrahydro-2H-pyran-3-yl]oxy}-3-{[(2R,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-({(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[2-(pyridin-2-ylamino)ethyl]tetrahydro-2H-pyran-2-yl}oxy)tetrahydro-2H-pyran-2-yl]oxy}tetrahydro-2H-pyran-2,4,5-triol (non-preferred name)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
4-Nitrophenyl 6'-deoxy-6'-(2-pyridylamino)-a-D-penta-(1-4)-glucopyranoside
CAS:4-Nitrophenyl 6'-deoxy-6'-(2-pyridylamino)-a-D-penta-(1-4)-glucopyranoside is a fluorescent substrate for the enzyme beta glucosidase. It is a chemiluminescent reagent that can be used to measure beta glucosidase activity. The substrate is an excellent high quality chemical and has been tested for environmental safety, heavy metal content and staining. 4-Nitrophenyl 6'-deoxy-6'-(2-pyridylamino)-a-D-penta-(1-4)-glucopyranoside is a chromogenic substrate that can be used in diagnostic testing, such as bioluminescence or fluorogenic assay. This product can also be used as a culture media additive or food testing agent.Purity:Min. 95%Molecular weight:1,025.91 g/mol

