CymitQuimica logo

CAS 100114-41-8

:

3-(2-amino-1,3-thiazol-4-yl)propanoic acid

Description:
3-(2-amino-1,3-thiazol-4-yl)propanoic acid, with the CAS number 100114-41-8, is an organic compound characterized by its thiazole ring and amino acid structure. It features a propanoic acid backbone, which contributes to its classification as an amino acid derivative. The presence of the thiazole moiety imparts unique chemical properties, including potential biological activity, as thiazoles are often found in various pharmaceuticals and bioactive compounds. This substance is likely to exhibit polar characteristics due to the carboxylic acid group, which can participate in hydrogen bonding, enhancing its solubility in polar solvents. Additionally, the amino group can engage in interactions with other biomolecules, making it relevant in biochemical contexts. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of compounds targeting specific biological pathways. Overall, 3-(2-amino-1,3-thiazol-4-yl)propanoic acid is a compound of interest in both synthetic and medicinal chemistry due to its unique structural attributes and potential functional roles.
Formula:C6H8N2O2S
InChI:InChI=1/C6H8N2O2S/c7-6-8-4(3-11-6)1-2-5(9)10/h3H,1-2H2,(H2,7,8)(H,9,10)
InChI key:VJYCHPGHOKIDDH-UHFFFAOYSA-N
SMILES:C(CC(=O)O)c1csc(=N)[nH]1
Synonyms:
  • 4-Thiazolepropanoic Acid, 2-Amino-
Found 2 products.