CAS 100114-57-6
:3-CYCLOPROPYL-1H-PYRAZOLE
Description:
3-Cyclopropyl-1H-pyrazole is an organic compound characterized by its pyrazole ring, which is a five-membered ring containing two adjacent nitrogen atoms. The presence of a cyclopropyl group, a three-membered carbon ring, at the 3-position of the pyrazole structure contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its potential biological activity, making it of interest in medicinal chemistry and drug development. The compound may exhibit various functional properties, including potential anti-inflammatory or analgesic effects, although specific biological activities can vary based on structural modifications and substituents. In terms of solubility, 3-cyclopropyl-1H-pyrazole is generally soluble in organic solvents, which is common for many pyrazole derivatives. Its reactivity can be influenced by the presence of the cyclopropyl group, which may participate in various chemical reactions, including substitution and addition reactions. Overall, this compound represents a significant area of study in organic and medicinal chemistry.
Formula:C6H8N2
InChI:InChI=1/C6H8N2/c1-2-5(1)6-3-4-7-8-6/h3-5H,1-2H2,(H,7,8)
SMILES:C1CC1c1cc[nH]n1
Synonyms:- Akos B021889
- Art-Chem-Bb B021889
- 5-cyclopropyl-1H-pyrazole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Cyclopropyl-1H-pyrazole, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C6H8N2Purity:98%Molecular weight:108.143-Cyclopropyl-1H-pyrazole
CAS:3-Cyclopropyl-1H-pyrazoleFormula:C6H8N2Purity:98%Color and Shape:Liquid-OilMolecular weight:108.141121H-Pyrazole, 3-cyclopropyl-
CAS:Formula:C6H8N2Purity:98%Color and Shape:LiquidMolecular weight:108.1411



