CAS 1001163-19-4

P-(3-Azidopropyl)phosphonic acid

Description:

P-(3-Azidopropyl)phosphonic acid is a chemical compound characterized by the presence of a phosphonic acid functional group and an azide group attached to a propyl chain. This compound typically exhibits properties associated with phosphonic acids, such as being a strong acid due to the presence of the phosphonic acid moiety, which can donate protons in solution. The azide group (-N3) is known for its reactivity, particularly in click chemistry and other synthetic applications, making this compound potentially useful in various chemical reactions, including those involving nucleophilic substitutions. The presence of both the azide and phosphonic acid functionalities suggests that it may serve as a versatile building block in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals. Additionally, the compound may exhibit solubility in polar solvents, which is typical for phosphonic acids, and may have specific applications in materials science or biochemistry due to its unique structural features. Safety precautions should be taken when handling this compound, as azides can be hazardous under certain conditions.

Formula: C₃H₈N₃O₃P

InChI: InChI=1S/C3H8N3O3P/c4-6-5-2-1-3-10(7,8)9/h1-3H2,(H2,7,8,9)

InChI key: InChIKey=DNZOJKWZPZNGEO-UHFFFAOYSA-N

SMILES: C(CP(=O)(O)O)CN=[N+]=[N-]

Synonyms:

• Phosphonic acid, P-(3-azidopropyl)-
• P-(3-Azidopropyl)phosphonic acid
• 3-Azidopropylphosphonic acid