CAS 10012-47-2
:Benzoic acid, 4-amino-, 2-(dimethylamino)ethyl ester
Description:
Benzoic acid, 4-amino-, 2-(dimethylamino)ethyl ester, commonly referred to by its CAS number 10012-47-2, is an organic compound characterized by its ester functional group and the presence of both an amino group and a dimethylamino group. This compound typically appears as a white to off-white solid and is soluble in organic solvents, reflecting its ester nature. The presence of the amino group suggests potential basic properties, while the dimethylamino group can contribute to its nucleophilicity and reactivity in various chemical reactions. Benzoic acid derivatives are often studied for their biological activity, including antimicrobial and anti-inflammatory properties. The compound may also exhibit moderate to low toxicity, necessitating careful handling in laboratory settings. Its structural features allow for potential applications in pharmaceuticals, agrochemicals, and as intermediates in organic synthesis. As with many organic compounds, stability can be influenced by environmental factors such as pH and temperature, making it essential to store and use it under appropriate conditions.
Formula:C11H16N2O2
InChI:InChI=1S/C11H16N2O2/c1-13(2)7-8-15-11(14)9-3-5-10(12)6-4-9/h3-6H,7-8,12H2,1-2H3
InChI key:InChIKey=MXBCQLLLJGRMJI-UHFFFAOYSA-N
SMILES:C(OCCN(C)C)(=O)C1=CC=C(N)C=C1
Synonyms:- (Dimethylamino)ethyl p-aminobenzoate
- Benzoic acid, p-amino-, 2- (dimethylamino)ethyl ester
- 2-(Dimethylamino)ethyl 4-aminobenzoate
- Benzoic acid, 4-amino-, 2- (dimethylamino)ethyl ester
- Ethanol, 2-dimethylamino-, p-aminobenzoate
- Benzoic acid, p-amino-, 2-(dimethylamino)ethyl ester
- Benzoic acid, 4-amino-, 2-(dimethylamino)ethyl ester (9CI)
- Benzoic acid, 4-amino-, 2-(dimethylamino)ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

