CymitQuimica logo

CAS 1001227-83-3

:

Methyl α-(aminomethyl)-4-chlorobenzeneacetate

Description:
Methyl α-(aminomethyl)-4-chlorobenzeneacetate, identified by its CAS number 1001227-83-3, is a chemical compound that features a methyl ester functional group and an amino group attached to a chlorobenzene ring. This compound is characterized by its aromatic structure, which contributes to its stability and potential reactivity. The presence of the amino group suggests that it may participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions, making it of interest in synthetic organic chemistry. The chlorobenzene moiety can influence the compound's solubility and reactivity, while the ester group may undergo hydrolysis under certain conditions. Methyl α-(aminomethyl)-4-chlorobenzeneacetate may have applications in pharmaceuticals or agrochemicals, given its structural features that could interact with biological systems. However, specific safety and handling guidelines should be followed due to the potential toxicity associated with chlorinated compounds and amines. As with any chemical, proper characterization and analysis are essential for understanding its properties and potential applications.
Formula:C10H12ClNO2
InChI:InChI=1S/C10H12ClNO2/c1-14-10(13)9(6-12)7-2-4-8(11)5-3-7/h2-5,9H,6,12H2,1H3
InChI key:InChIKey=OFTXIFNBTWHKFG-UHFFFAOYSA-N
SMILES:C(C(OC)=O)(CN)C1=CC=C(Cl)C=C1
Synonyms:
  • Methyl α-(aminomethyl)-4-chlorobenzeneacetate
  • Benzeneacetic acid, α-(aminomethyl)-4-chloro-, methyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.