CAS 100124-06-9
:2-(4-Dihydroxyborane)phenyl-4-carboxy-6-methylquinoline
Description:
2-(4-Dihydroxyborane)phenyl-4-carboxy-6-methylquinoline, identified by its CAS number 100124-06-9, is a chemical compound that features a quinoline core substituted with various functional groups. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential fluorescence and reactivity due to the presence of the carboxylic acid and boron-containing groups. The dihydroxyborane moiety may impart unique coordination chemistry, allowing for interactions with other molecules or ions. The presence of hydroxyl groups suggests potential for hydrogen bonding, which can influence solubility and reactivity. Additionally, the methyl group on the quinoline ring can affect the electronic properties and steric hindrance of the molecule. Overall, this compound may be of interest in fields such as medicinal chemistry, materials science, or coordination chemistry, where its unique structural features could be leveraged for specific applications or studies.
Formula:C6H5BF2O2
InChI:InChI=1/C6H5BF2O2/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3,10-11H
SMILES:c1cc(c(cc1F)F)B(O)O
Synonyms:- Dibenzofuran-4-boronic acid
- Dibenzo[b,d]furan-4-ylboronic acid
- (2,4-Difluorophenyl)Boronic Acid
- 4-(Dibenzofuranyl)boronic acid
- 4-Dibenzofuranboronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Dibenzofuran-4-boronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C12H9BO3Color and Shape:White to Almost white powder to crystalMolecular weight:212.01Dibenzofuran-4-boronic acid, 98+%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C12H9BO3Purity:98+%Color and Shape:Powder, WhiteMolecular weight:212.01Dibenzo[b,d]furan-4-boronic acid
CAS:Dibenzo[b,d]furan-4-boronic acidFormula:C12H9BO3Purity:98%Color and Shape:SolidMolecular weight:212.00906Boronic acid, B-4-dibenzofuranyl-
CAS:Formula:C12H9BO3Purity:98%Color and Shape:SolidMolecular weight:212.0091Ref: IN-DA00010T
5g20.00€1g21.00€10g29.00€25g37.00€50g58.00€100g85.00€250g166.00€500g235.00€1kg622.00€Dibenzofuran-4-boronic acid
CAS:Formula:C12H9BO3Purity:97%Color and Shape:SolidMolecular weight:212.01





