CAS 100129-07-5
:N-benzyl-2-bromo-N-methylpropanamide
Description:
N-benzyl-2-bromo-N-methylpropanamide is an organic compound characterized by its amide functional group, which is derived from the reaction of a carboxylic acid and an amine. This compound features a benzyl group, a bromine atom, and a methyl group attached to a propanamide backbone. The presence of the bromine atom introduces notable reactivity, making it a potential candidate for various chemical transformations, including nucleophilic substitutions. The benzyl group contributes to the compound's hydrophobic character, while the amide functionality can engage in hydrogen bonding, influencing its solubility and boiling point. Typically, compounds like N-benzyl-2-bromo-N-methylpropanamide are utilized in organic synthesis and medicinal chemistry, where they may serve as intermediates or building blocks for more complex molecules. Additionally, the compound's structure suggests potential applications in drug development, particularly in the design of pharmaceuticals that target specific biological pathways. Overall, its unique combination of functional groups and structural features makes it a compound of interest in various chemical research fields.
Formula:C11H14BrNO
InChI:InChI=1/C11H14BrNO/c1-9(12)11(14)13(2)8-10-6-4-3-5-7-10/h3-7,9H,8H2,1-2H3
Synonyms:- propanamide, 2-bromo-N-methyl-N-(phenylmethyl)-
- N-Benzyl-2-bromo-N-methylpropanamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.