CAS 100129-45-1
:3-chloro-N-ethyl-N-phenylpropanamide
Description:
3-Chloro-N-ethyl-N-phenylpropanamide is an organic compound characterized by its amide functional group, which is derived from propanoic acid. The presence of a chlorine atom at the third carbon position and ethyl and phenyl groups attached to the nitrogen atom contribute to its unique chemical properties. This compound typically appears as a solid or liquid, depending on the specific conditions, and is known for its moderate solubility in organic solvents. Its molecular structure suggests potential applications in pharmaceuticals or agrochemicals, where the chlorine substituent may enhance biological activity or modify reactivity. The compound's reactivity can be influenced by the electron-withdrawing nature of the chlorine atom, which can affect nucleophilic attack and other chemical interactions. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks. Overall, 3-chloro-N-ethyl-N-phenylpropanamide exemplifies the complexity of organic compounds and their diverse applications in various fields of chemistry.
Formula:C11H14ClNO
InChI:InChI=1/C11H14ClNO/c1-2-13(11(14)8-9-12)10-6-4-3-5-7-10/h3-7H,2,8-9H2,1H3
SMILES:CCN(c1ccccc1)C(=O)CCCl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
