CAS 100130-32-3
:Carbamimidothioic acid, 2-[(aminoiminomethyl)amino]ethyl ester, dihydrobromide
Description:
Carbamimidothioic acid, 2-[(aminoiminomethyl)amino]ethyl ester, dihydrobromide, also known by its CAS number 100130-32-3, is a chemical compound characterized by its complex structure, which includes a carbamimidothioic acid moiety and an amino group. This compound typically appears as a crystalline solid and is soluble in water due to the presence of ionic bromide groups. It exhibits properties associated with both thiols and amines, making it a potential candidate for various biochemical applications, including as a reagent in organic synthesis or as a ligand in coordination chemistry. The dihydrobromide form indicates the presence of two bromide ions, which can influence its reactivity and solubility. Additionally, the compound may exhibit biological activity, potentially interacting with biological systems through its functional groups. As with many chemical substances, safety precautions should be observed when handling this compound, as it may pose health risks or environmental hazards.
Formula:C4H11N5S·2BrH
InChI:InChI=1S/C4H11N5S.2BrH/c5-3(6)9-1-2-10-4(7)8;;/h1-2H2,(H3,7,8)(H4,5,6,9);2*1H
InChI key:InChIKey=GPWJSTKHQMIXCA-UHFFFAOYSA-N
SMILES:C(CSC(=N)N)NC(=N)N.Br
Synonyms:- 2-(2-Guanidinoethyl)-2-thiopseudourea dihydrobromide
- 2-Guanidinoethyl carbamimidothioate dihydrobromide
- 2-[(Diaminomethylidene)Amino]Ethyl Imidothiocarbamate Dihydrobromide
- Carbamimidothioic acid, 2-((aminoiminomethyl)amino)ethyl ester, dihydrobromide
- Pseudourea, 2-(2-guanidinoethyl)-2-thio-, dihydrobromide
- S,2-Guanidinoethylisothiuronium bromide hydrobromide
- VUF 8430 dihydrobromide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
VUF8430 (hydrobromide)
CAS:VUF8430 (hydrobromide)Formula:C4H13Br2N5SPurity:≥95%Molecular weight:323.05VUF8430 (hydrobromide)
CAS:Formula:C4H13Br2N5SPurity:95%Color and Shape:SolidMolecular weight:323.0525VUF 8430 dihydrobromide
CAS:VUF 8430 dihydrobromide (VUF) is a histamine H2 receptor antagonist that blocks the interaction between histamine and its receptors. It has been shown to regulate the release of granules from cells, which are part of the inflammatory process. VUF has been shown to have a beneficial effect on neuroinflammation in animals. VUF is also able to block histamine H1 receptor activation, leading to an anti-allergic effect. In vitro studies have found that VUF blocks the activity of decarboxylase, which is responsible for producing histamine. This drug has not been tested on humans or animals with a genetic mutation in their H2 receptors.Formula:C4H11N5S·2HBrPurity:Min. 95%Molecular weight:323.05 g/molVUF 8430 dihydrobromide
CAS:histamine H4 receptor full agonistFormula:C4H13Br2N5SPurity:98%Color and Shape:SolidMolecular weight:323.05





