CymitQuimica logo

CAS 100131-99-5

:

3-Butyl-3-azabicyclo[3.2.0]heptane-2,4-dione

Description:
3-Butyl-3-azabicyclo[3.2.0]heptane-2,4-dione, with the CAS number 100131-99-5, is a bicyclic compound characterized by its unique structural framework that includes a nitrogen atom within a bicyclic system. This compound features a butyl substituent, which contributes to its hydrophobic properties, and two carbonyl groups (diones) that enhance its reactivity and potential for forming hydrogen bonds. The bicyclic structure imparts rigidity to the molecule, influencing its conformational stability and interactions with other chemical species. The presence of the azabicyclic moiety suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to mimic natural products or serve as a scaffold for drug design. Additionally, the compound's dione functionality may allow for various chemical transformations, making it a versatile intermediate in organic synthesis. Overall, 3-Butyl-3-azabicyclo[3.2.0]heptane-2,4-dione is notable for its structural complexity and potential utility in various chemical applications.
Formula:C10H15NO2
InChI:InChI=1S/C10H15NO2/c1-2-3-6-11-9(12)7-4-5-8(7)10(11)13/h7-8H,2-6H2,1H3
InChI key:InChIKey=NTMJGOSNSFYNGY-UHFFFAOYSA-N
SMILES:O=C1C2C(C(=O)N1CCCC)CC2
Synonyms:
  • 3-Butyl-3-azabicyclo[3.2.0]heptane-2,4-dione
  • 1,2-Cyclobutanedicarboximide, N-butyl-
  • 3-Azabicyclo[3.2.0]heptane-2,4-dione, 3-butyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.